C21H27NO — CID 141358360
3-[(3R)-1-benzyl-3-ethylazepan-3-yl]phenol (PubChem CID 141358360) has the molecular formula C21H27NO and a molecular weight of 309.45 g/mol. Its IUPAC name is 3-[(3R)-1-benzyl-3-ethylazepan-3-yl]phenol.
| Compound Name | 3-[(3R)-1-benzyl-3-ethylazepan-3-yl]phenol |
|---|---|
| PubChem CID | 141358360 |
| Molecular Formula | C21H27NO |
| Molecular Weight | 309.45 g/mol |
| Exact Mass | 309.21 |
| IUPAC Name | 3-[(3R)-1-benzyl-3-ethylazepan-3-yl]phenol |
| SMILES | CC[C@]1(c2cccc(O)c2)CCCCN(Cc2ccccc2)C1 |
| InChI | InChI=1S/C21H27NO/c1-2-21(19-11-8-12-20(23)15-19)13-6-7-14-22(17-21)16-18-9-4-3-5-10-18/h3-5,8-12,15,23H,2,6-7,13-14,16-17H2,1H3/t21-/m0/s1 |
| InChIKey | DJJRPKDHYKAJHK-NRFANRHFSA-N |
| XLogP | 4.73 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.45 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |