C13H12N2O4 — CID 154127771
ethyl 2-(2,1,3-benzoxadiazol-4-ylmethylidene)-3-oxobutanoate (PubChem CID 154127771) has the molecular formula C13H12N2O4 and a molecular weight of 260.25 g/mol. Its IUPAC name is ethyl 2-(2,1,3-benzoxadiazol-4-ylmethylidene)-3-oxobutanoate.
| Compound Name | ethyl 2-(2,1,3-benzoxadiazol-4-ylmethylidene)-3-oxobutanoate |
|---|---|
| PubChem CID | 154127771 |
| Molecular Formula | C13H12N2O4 |
| Molecular Weight | 260.25 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | ethyl 2-(2,1,3-benzoxadiazol-4-ylmethylidene)-3-oxobutanoate |
| SMILES | CCOC(=O)C(=Cc1cccc2nonc12)C(C)=O |
| InChI | InChI=1S/C13H12N2O4/c1-3-18-13(17)10(8(2)16)7-9-5-4-6-11-12(9)15-19-14-11/h4-7H,3H2,1-2H3 |
| InChIKey | OVCVQQFJSBQQTC-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 82.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.25 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|