C16H18Si — CID 154128110
2,2-diphenylethenyl(ethyl)silane (PubChem CID 154128110) has the molecular formula C16H18Si and a molecular weight of 238.41 g/mol. Its IUPAC name is 2,2-diphenylethenyl(ethyl)silane.
| Compound Name | 2,2-diphenylethenyl(ethyl)silane |
|---|---|
| PubChem CID | 154128110 |
| Molecular Formula | C16H18Si |
| Molecular Weight | 238.41 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | 2,2-diphenylethenyl(ethyl)silane |
| SMILES | CC[SiH2]C=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H18Si/c1-2-17-13-16(14-9-5-3-6-10-14)15-11-7-4-8-12-15/h3-13H,2,17H2,1H3 |
| InChIKey | GUIMISVVABLQIO-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.41 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|