C15H12Cl4N2O — CID 154128737
2,4-bis(3,5-dichloro-4-pyridinyl)pentan-3-one (PubChem CID 154128737) has the molecular formula C15H12Cl4N2O and a molecular weight of 378.09 g/mol. Its IUPAC name is 2,4-bis(3,5-dichloro-4-pyridinyl)pentan-3-one.
| Compound Name | 2,4-bis(3,5-dichloro-4-pyridinyl)pentan-3-one |
|---|---|
| PubChem CID | 154128737 |
| Molecular Formula | C15H12Cl4N2O |
| Molecular Weight | 378.09 g/mol |
| Exact Mass | 375.97 |
| IUPAC Name | 2,4-bis(3,5-dichloro-4-pyridinyl)pentan-3-one |
| SMILES | CC(C(=O)C(C)c1c(Cl)cncc1Cl)c1c(Cl)cncc1Cl |
| InChI | InChI=1S/C15H12Cl4N2O/c1-7(13-9(16)3-20-4-10(13)17)15(22)8(2)14-11(18)5-21-6-12(14)19/h3-8H,1-2H3 |
| InChIKey | WUMBNKPGRMEGIX-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.09 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |