C21H32O3 — CID 154142609
3-hydroxy-2,3,7-trimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-4,6,8-trienoic acid (PubChem CID 154142609) has the molecular formula C21H32O3 and a molecular weight of 332.48 g/mol. Its IUPAC name is 3-hydroxy-2,3,7-trimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-4,6,8-trienoic acid.
| Compound Name | 3-hydroxy-2,3,7-trimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-4,6,8-trienoic acid |
|---|---|
| PubChem CID | 154142609 |
| Molecular Formula | C21H32O3 |
| Molecular Weight | 332.48 g/mol |
| Exact Mass | 332.24 |
| IUPAC Name | 3-hydroxy-2,3,7-trimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-4,6,8-trienoic acid |
| SMILES | CC(C=CC1=C(C)CCCC1(C)C)=CC=CC(C)(O)C(C)C(=O)O |
| InChI | InChI=1S/C21H32O3/c1-15(9-7-14-21(6,24)17(3)19(22)23)11-12-18-16(2)10-8-13-20(18,4)5/h7,9,11-12,14,17,24H,8,10,13H2,1-6H3,(H,22,23) |
| InChIKey | NVKXKCHKKMMFPQ-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.48 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|