C5H10N2O3 — CID 154142904
3-ethenyl-1,1-bis(hydroxymethyl)urea (PubChem CID 154142904) has the molecular formula C5H10N2O3 and a molecular weight of 146.15 g/mol. Its IUPAC name is 3-ethenyl-1,1-bis(hydroxymethyl)urea.
| Compound Name | 3-ethenyl-1,1-bis(hydroxymethyl)urea |
|---|---|
| PubChem CID | 154142904 |
| Molecular Formula | C5H10N2O3 |
| Molecular Weight | 146.15 g/mol |
| Exact Mass | 146.07 |
| IUPAC Name | 3-ethenyl-1,1-bis(hydroxymethyl)urea |
| SMILES | C=CNC(=O)N(CO)CO |
| InChI | InChI=1S/C5H10N2O3/c1-2-6-5(10)7(3-8)4-9/h2,8-9H,1,3-4H2,(H,6,10) |
| InChIKey | RDJPEQMBTXAQRM-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.15 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|