C10H26O3Si3 — CID 154145328
(2-ethenylsilyloxy-1-trimethylsilyloxyethoxy)-trimethylsilane (PubChem CID 154145328) has the molecular formula C10H26O3Si3 and a molecular weight of 278.57 g/mol. Its IUPAC name is (2-ethenylsilyloxy-1-trimethylsilyloxyethoxy)-trimethylsilane.
| Compound Name | (2-ethenylsilyloxy-1-trimethylsilyloxyethoxy)-trimethylsilane |
|---|---|
| PubChem CID | 154145328 |
| Molecular Formula | C10H26O3Si3 |
| Molecular Weight | 278.57 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | (2-ethenylsilyloxy-1-trimethylsilyloxyethoxy)-trimethylsilane |
| SMILES | C=C[SiH2]OCC(O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C10H26O3Si3/c1-8-14-11-9-10(12-15(2,3)4)13-16(5,6)7/h8,10H,1,9,14H2,2-7H3 |
| InChIKey | MMGITEFVTPHZME-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.57 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|