C22H44O3Si — CID 154082860
18,18-dimethoxyoctadec-9-enoxy(ethenyl)silane (PubChem CID 154082860) has the molecular formula C22H44O3Si and a molecular weight of 384.68 g/mol. Its IUPAC name is 18,18-dimethoxyoctadec-9-enoxy(ethenyl)silane.
| Compound Name | 18,18-dimethoxyoctadec-9-enoxy(ethenyl)silane |
|---|---|
| PubChem CID | 154082860 |
| Molecular Formula | C22H44O3Si |
| Molecular Weight | 384.68 g/mol |
| Exact Mass | 384.31 |
| IUPAC Name | 18,18-dimethoxyoctadec-9-enoxy(ethenyl)silane |
| SMILES | C=C[SiH2]OCCCCCCCCC=CCCCCCCCC(OC)OC |
| InChI | InChI=1S/C22H44O3Si/c1-4-26-25-21-19-17-15-13-11-9-7-5-6-8-10-12-14-16-18-20-22(23-2)24-3/h4-6,22H,1,7-21,26H2,2-3H3 |
| InChIKey | XDAULZTTWJVDGO-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.68 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|