C18H24N4S — CID 154146696
N'-(cyclohexylmethyl)-4-methyl-N-(4-methylphenyl)thiadiazole-5-carboximidamide (PubChem CID 154146696) has the molecular formula C18H24N4S and a molecular weight of 328.49 g/mol. Its IUPAC name is N'-(cyclohexylmethyl)-4-methyl-N-(4-methylphenyl)thiadiazole-5-carboximidamide.
| Compound Name | N'-(cyclohexylmethyl)-4-methyl-N-(4-methylphenyl)thiadiazole-5-carboximidamide |
|---|---|
| PubChem CID | 154146696 |
| Molecular Formula | C18H24N4S |
| Molecular Weight | 328.49 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | N'-(cyclohexylmethyl)-4-methyl-N-(4-methylphenyl)thiadiazole-5-carboximidamide |
| SMILES | Cc1ccc(N/C(=N/CC2CCCCC2)c2snnc2C)cc1 |
| InChI | InChI=1S/C18H24N4S/c1-13-8-10-16(11-9-13)20-18(17-14(2)21-22-23-17)19-12-15-6-4-3-5-7-15/h8-11,15H,3-7,12H2,1-2H3,(H,19,20) |
| InChIKey | AHPRDPCQYHFHPF-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 50.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.49 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|