C21H46O5Si2 — CID 154148708
3,13-bis(dimethoxysilyl)-3,13-dimethylpentadecan-8-one (PubChem CID 154148708) has the molecular formula C21H46O5Si2 and a molecular weight of 434.77 g/mol. Its IUPAC name is 3,13-bis(dimethoxysilyl)-3,13-dimethylpentadecan-8-one.
| Compound Name | 3,13-bis(dimethoxysilyl)-3,13-dimethylpentadecan-8-one |
|---|---|
| PubChem CID | 154148708 |
| Molecular Formula | C21H46O5Si2 |
| Molecular Weight | 434.77 g/mol |
| Exact Mass | 434.29 |
| IUPAC Name | 3,13-bis(dimethoxysilyl)-3,13-dimethylpentadecan-8-one |
| SMILES | CCC(C)(CCCCC(=O)CCCCC(C)(CC)[SiH](OC)OC)[SiH](OC)OC |
| InChI | InChI=1S/C21H46O5Si2/c1-9-20(3,27(23-5)24-6)17-13-11-15-19(22)16-12-14-18-21(4,10-2)28(25-7)26-8/h27-28H,9-18H2,1-8H3 |
| InChIKey | DAGYIUVCHDTAPR-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.77 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|