C23H30O3 — CID 154151318
(8S,9S,10R,13S,14S,16R,17S)-17-acetyl-6,10,13,16-tetramethyl-2,8,9,12,14,15,16,17-octahydro-1H-cyclopenta[a]phenanthrene-3,11-dione (PubChem CID 154151318) has the molecular formula C23H30O3 and a molecular weight of 354.49 g/mol. Its IUPAC name is (8S,9S,10R,13S,14S,16R,17S)-17-acetyl-6,10,13,16-tetramethyl-2,8,9,12,14,15,16,17-octahydro-1H-cyclopenta[a]phenanthrene-3,11-dione.
| Compound Name | (8S,9S,10R,13S,14S,16R,17S)-17-acetyl-6,10,13,16-tetramethyl-2,8,9,12,14,15,16,17-octahydro-1H-cyclopenta[a]phenanthrene-3,11-dione |
|---|---|
| PubChem CID | 154151318 |
| Molecular Formula | C23H30O3 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | (8S,9S,10R,13S,14S,16R,17S)-17-acetyl-6,10,13,16-tetramethyl-2,8,9,12,14,15,16,17-octahydro-1H-cyclopenta[a]phenanthrene-3,11-dione |
| SMILES | CC(=O)[C@H]1[C@H](C)C[C@H]2[C@@H]3C=C(C)C4=CC(=O)CC[C@]4(C)[C@H]3C(=O)C[C@@]21C |
| InChI | InChI=1S/C23H30O3/c1-12-8-16-18-9-13(2)20(14(3)24)23(18,5)11-19(26)21(16)22(4)7-6-15(25)10-17(12)22/h8,10,13,16,18,20-21H,6-7,9,11H2,1-5H3/t13-,16+,18+,20-,21-,22+,23+/m1/s1 |
| InChIKey | KKSIBYDUDYAEPT-PEAFRJDLSA-N |
| XLogP | 4.31 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |