C11H16N2O4S — CID 154156454
(2R,3R)-2-amino-3-hydroxy-2-(4-methylphenyl)sulfonylbutanamide (PubChem CID 154156454) has the molecular formula C11H16N2O4S and a molecular weight of 272.33 g/mol. Its IUPAC name is (2R,3R)-2-amino-3-hydroxy-2-(4-methylphenyl)sulfonylbutanamide.
| Compound Name | (2R,3R)-2-amino-3-hydroxy-2-(4-methylphenyl)sulfonylbutanamide |
|---|---|
| PubChem CID | 154156454 |
| Molecular Formula | C11H16N2O4S |
| Molecular Weight | 272.33 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | (2R,3R)-2-amino-3-hydroxy-2-(4-methylphenyl)sulfonylbutanamide |
| SMILES | Cc1ccc(S(=O)(=O)[C@@](N)(C(N)=O)[C@@H](C)O)cc1 |
| InChI | InChI=1S/C11H16N2O4S/c1-7-3-5-9(6-4-7)18(16,17)11(13,8(2)14)10(12)15/h3-6,8,14H,13H2,1-2H3,(H2,12,15)/t8-,11-/m1/s1 |
| InChIKey | ILGCEDLZJJXYDH-LDYMZIIASA-N |
| XLogP | -0.71 |
| TPSA | 123.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.33 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |