C10H11F3N2O4S — CID 154126143
(2R)-2-amino-3-hydroxy-2-[4-(trifluoromethyl)phenyl]sulfonylpropanamide (PubChem CID 154126143) has the molecular formula C10H11F3N2O4S and a molecular weight of 312.27 g/mol. Its IUPAC name is (2R)-2-amino-3-hydroxy-2-[4-(trifluoromethyl)phenyl]sulfonylpropanamide.
| Compound Name | (2R)-2-amino-3-hydroxy-2-[4-(trifluoromethyl)phenyl]sulfonylpropanamide |
|---|---|
| PubChem CID | 154126143 |
| Molecular Formula | C10H11F3N2O4S |
| Molecular Weight | 312.27 g/mol |
| Exact Mass | 312.04 |
| IUPAC Name | (2R)-2-amino-3-hydroxy-2-[4-(trifluoromethyl)phenyl]sulfonylpropanamide |
| SMILES | NC(=O)[C@@](N)(CO)S(=O)(=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C10H11F3N2O4S/c11-10(12,13)6-1-3-7(4-2-6)20(18,19)9(15,5-16)8(14)17/h1-4,16H,5,15H2,(H2,14,17)/t9-/m1/s1 |
| InChIKey | CPWHHTMXDCVGIC-SECBINFHSA-N |
| XLogP | -0.39 |
| TPSA | 123.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.27 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |