C14H22N2O5S — CID 151966798
(2R)-2-amino-N,3-dihydroxy-2-[4-(2-methylbutan-2-yl)phenyl]sulfonylpropanamide (PubChem CID 151966798) has the molecular formula C14H22N2O5S and a molecular weight of 330.41 g/mol. Its IUPAC name is (2R)-2-amino-N,3-dihydroxy-2-[4-(2-methylbutan-2-yl)phenyl]sulfonylpropanamide.
| Compound Name | (2R)-2-amino-N,3-dihydroxy-2-[4-(2-methylbutan-2-yl)phenyl]sulfonylpropanamide |
|---|---|
| PubChem CID | 151966798 |
| Molecular Formula | C14H22N2O5S |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | (2R)-2-amino-N,3-dihydroxy-2-[4-(2-methylbutan-2-yl)phenyl]sulfonylpropanamide |
| SMILES | CCC(C)(C)c1ccc(S(=O)(=O)[C@](N)(CO)C(=O)NO)cc1 |
| InChI | InChI=1S/C14H22N2O5S/c1-4-13(2,3)10-5-7-11(8-6-10)22(20,21)14(15,9-17)12(18)16-19/h5-8,17,19H,4,9,15H2,1-3H3,(H,16,18)/t14-/m1/s1 |
| InChIKey | TZVHWECQRPWYEA-CQSZACIVSA-N |
| XLogP | 0.30 |
| TPSA | 129.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|