C12H18N2O5S — CID 87749254
3-hydroxy-2-[hydroxy-(4-propylphenyl)sulfonylamino]propanamide (PubChem CID 87749254) has the molecular formula C12H18N2O5S and a molecular weight of 302.35 g/mol. Its IUPAC name is 3-hydroxy-2-[hydroxy-(4-propylphenyl)sulfonylamino]propanamide.
| Compound Name | 3-hydroxy-2-[hydroxy-(4-propylphenyl)sulfonylamino]propanamide |
|---|---|
| PubChem CID | 87749254 |
| Molecular Formula | C12H18N2O5S |
| Molecular Weight | 302.35 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | 3-hydroxy-2-[hydroxy-(4-propylphenyl)sulfonylamino]propanamide |
| SMILES | CCCc1ccc(S(=O)(=O)N(O)C(CO)C(N)=O)cc1 |
| InChI | InChI=1S/C12H18N2O5S/c1-2-3-9-4-6-10(7-5-9)20(18,19)14(17)11(8-15)12(13)16/h4-7,11,15,17H,2-3,8H2,1H3,(H2,13,16) |
| InChIKey | NNECAOOZPGVEGN-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 120.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.35 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|