C10H14N2O4S — CID 143175700
(2R)-2-amino-3-hydroxy-2-(4-methylphenyl)sulfonylpropanamide (PubChem CID 143175700) has the molecular formula C10H14N2O4S and a molecular weight of 258.30 g/mol. Its IUPAC name is (2R)-2-amino-3-hydroxy-2-(4-methylphenyl)sulfonylpropanamide.
| Compound Name | (2R)-2-amino-3-hydroxy-2-(4-methylphenyl)sulfonylpropanamide |
|---|---|
| PubChem CID | 143175700 |
| Molecular Formula | C10H14N2O4S |
| Molecular Weight | 258.30 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | (2R)-2-amino-3-hydroxy-2-(4-methylphenyl)sulfonylpropanamide |
| SMILES | Cc1ccc(S(=O)(=O)[C@](N)(CO)C(N)=O)cc1 |
| InChI | InChI=1S/C10H14N2O4S/c1-7-2-4-8(5-3-7)17(15,16)10(12,6-13)9(11)14/h2-5,13H,6,12H2,1H3,(H2,11,14)/t10-/m1/s1 |
| InChIKey | RHWINQPGEPRQFR-SNVBAGLBSA-N |
| XLogP | -1.10 |
| TPSA | 123.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.30 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |