C25H32N2O6 — CID 154157564
[(1S,13R,14S,17S,19S)-10-hydroxy-20-hydroxyimino-13,14,18,18-tetramethyl-7-oxo-2-oxa-6-azapentacyclo[11.8.0.01,17.03,11.04,8]henicosa-3,8,10-trien-19-yl] acetate (PubChem CID 154157564) has the molecular formula C25H32N2O6 and a molecular weight of 456.54 g/mol. Its IUPAC name is [(1S,13R,14S,17S,19S)-10-hydroxy-20-hydroxyimino-13,14,18,18-tetramethyl-7-oxo-2-oxa-6-azapentacyclo[11.8.0.01,17.03,11.04,8]henicosa-3,8,10-trien-19-yl] acetate.
| Compound Name | [(1S,13R,14S,17S,19S)-10-hydroxy-20-hydroxyimino-13,14,18,18-tetramethyl-7-oxo-2-oxa-6-azapentacyclo[11.8.0.01,17.03,11.04,8]henicosa-3,8,10-trien-19-yl] acetate |
|---|---|
| PubChem CID | 154157564 |
| Molecular Formula | C25H32N2O6 |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.23 |
| IUPAC Name | [(1S,13R,14S,17S,19S)-10-hydroxy-20-hydroxyimino-13,14,18,18-tetramethyl-7-oxo-2-oxa-6-azapentacyclo[11.8.0.01,17.03,11.04,8]henicosa-3,8,10-trien-19-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C(=NO)C[C@@]23Oc4c(c(O)cc5c4CNC5=O)C[C@]2(C)[C@@H](C)CC[C@H]3C1(C)C |
| InChI | InChI=1S/C25H32N2O6/c1-12-6-7-19-23(3,4)21(32-13(2)28)17(27-31)10-25(19)24(12,5)9-15-18(29)8-14-16(20(15)33-25)11-26-22(14)30/h8,12,19,21,29,31H,6-7,9-11H2,1-5H3,(H,26,30)/t12-,19-,21+,24+,25-/m0/s1 |
| InChIKey | VYCQOKWXDIQFOV-UJJSRWCZSA-N |
| XLogP | 3.55 |
| TPSA | 117.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|