About butyl(2-ethylbutoxy)tin
butyl(2-ethylbutoxy)tin (PubChem CID 154163781) has the molecular formula C10H22OSn
and a molecular weight of 277.00 g/mol. Its IUPAC name is butyl(2-ethylbutoxy)tin.
Molecular Properties
| Compound Name | butyl(2-ethylbutoxy)tin |
| PubChem CID | 154163781 |
| Molecular Formula | C10H22OSn |
| Molecular Weight | 277.00 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | butyl(2-ethylbutoxy)tin |
| SMILES | CCCC[Sn]OCC(CC)CC |
| InChI | InChI=1S/C6H13O.C4H9.Sn/c1-3-6(4-2)5-7;1-3-4-2;/h6H,3-5H2,1-2H3;1,3-4H2,2H3;/q-1;;+1 |
| InChIKey | SVHSYFLYCSNCLT-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.00 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze butyl(2-ethylbutoxy)tin with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl(2-ethylbutoxy)tin?
The IUPAC name of butyl(2-ethylbutoxy)tin (CID 154163781) is butyl(2-ethylbutoxy)tin.
What is the SMILES notation for butyl(2-ethylbutoxy)tin?
The canonical SMILES for butyl(2-ethylbutoxy)tin is CCCC[Sn]OCC(CC)CC.
What is the InChIKey of butyl(2-ethylbutoxy)tin?
The InChIKey is SVHSYFLYCSNCLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13O.C4H9.Sn/c1-3-6(4-2)5-7;1-3-4-2;/h6H,3-5H2,1-2H3;1,3-4H2,2H3;/q-1;;+1.
What are the key properties of butyl(2-ethylbutoxy)tin?
butyl(2-ethylbutoxy)tin has a molecular weight of 277.00 g/mol, XLogP of 3.28, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for butyl(2-ethylbutoxy)tin is sourced from PubChem (CID 154163781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).