C7H14N4 — CID 154166879
4-propyl-1H-pyrimidine-4,6-diamine (PubChem CID 154166879) has the molecular formula C7H14N4 and a molecular weight of 154.22 g/mol. Its IUPAC name is 4-propyl-1H-pyrimidine-4,6-diamine.
| Compound Name | 4-propyl-1H-pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 154166879 |
| Molecular Formula | C7H14N4 |
| Molecular Weight | 154.22 g/mol |
| Exact Mass | 154.12 |
| IUPAC Name | 4-propyl-1H-pyrimidine-4,6-diamine |
| SMILES | CCCC1(N)C=C(N)NC=N1 |
| InChI | InChI=1S/C7H14N4/c1-2-3-7(9)4-6(8)10-5-11-7/h4-5H,2-3,8-9H2,1H3,(H,10,11) |
| InChIKey | OXPVAKLQDMAMOC-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 76.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.22 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |