C6H13ClN4 — CID 160579203
4-ethyl-1H-pyrimidine-2,4-diamine;hydrochloride (PubChem CID 160579203) has the molecular formula C6H13ClN4 and a molecular weight of 176.65 g/mol. Its IUPAC name is 4-ethyl-1H-pyrimidine-2,4-diamine;hydrochloride.
| Compound Name | 4-ethyl-1H-pyrimidine-2,4-diamine;hydrochloride |
|---|---|
| PubChem CID | 160579203 |
| Molecular Formula | C6H13ClN4 |
| Molecular Weight | 176.65 g/mol |
| Exact Mass | 176.08 |
| IUPAC Name | 4-ethyl-1H-pyrimidine-2,4-diamine;hydrochloride |
| SMILES | CCC1(N)C=CNC(N)=N1.Cl |
| InChI | InChI=1S/C6H12N4.ClH/c1-2-6(8)3-4-9-5(7)10-6;/h3-4H,2,8H2,1H3,(H3,7,9,10);1H |
| InChIKey | RBNXRIMWUJTIPB-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 76.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.65 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |