C6H11FN4 — CID 171648861
4-ethyl-5-fluoro-1H-pyrimidine-2,4-diamine (PubChem CID 171648861) has the molecular formula C6H11FN4 and a molecular weight of 158.18 g/mol. Its IUPAC name is 4-ethyl-5-fluoro-1H-pyrimidine-2,4-diamine.
| Compound Name | 4-ethyl-5-fluoro-1H-pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 171648861 |
| Molecular Formula | C6H11FN4 |
| Molecular Weight | 158.18 g/mol |
| Exact Mass | 158.10 |
| IUPAC Name | 4-ethyl-5-fluoro-1H-pyrimidine-2,4-diamine |
| SMILES | CCC1(N)N=C(N)NC=C1F |
| InChI | InChI=1S/C6H11FN4/c1-2-6(9)4(7)3-10-5(8)11-6/h3H,2,9H2,1H3,(H3,8,10,11) |
| InChIKey | XFKTUQBTILWKOA-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 76.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.18 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |