C6H9F3N4 — CID 143515499
4-(2,2,2-trifluoroethyl)-1H-pyrimidine-2,4-diamine (PubChem CID 143515499) has the molecular formula C6H9F3N4 and a molecular weight of 194.16 g/mol. Its IUPAC name is 4-(2,2,2-trifluoroethyl)-1H-pyrimidine-2,4-diamine.
| Compound Name | 4-(2,2,2-trifluoroethyl)-1H-pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 143515499 |
| Molecular Formula | C6H9F3N4 |
| Molecular Weight | 194.16 g/mol |
| Exact Mass | 194.08 |
| IUPAC Name | 4-(2,2,2-trifluoroethyl)-1H-pyrimidine-2,4-diamine |
| SMILES | NC1=NC(N)(CC(F)(F)F)C=CN1 |
| InChI | InChI=1S/C6H9F3N4/c7-6(8,9)3-5(11)1-2-12-4(10)13-5/h1-2H,3,11H2,(H3,10,12,13) |
| InChIKey | KVEZCGBYFGUHNJ-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 76.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.16 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |