C7H11F3N4 — CID 154281463
4-ethyl-5-(trifluoromethyl)-1H-pyrimidine-2,4-diamine (PubChem CID 154281463) has the molecular formula C7H11F3N4 and a molecular weight of 208.19 g/mol. Its IUPAC name is 4-ethyl-5-(trifluoromethyl)-1H-pyrimidine-2,4-diamine.
| Compound Name | 4-ethyl-5-(trifluoromethyl)-1H-pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 154281463 |
| Molecular Formula | C7H11F3N4 |
| Molecular Weight | 208.19 g/mol |
| Exact Mass | 208.09 |
| IUPAC Name | 4-ethyl-5-(trifluoromethyl)-1H-pyrimidine-2,4-diamine |
| SMILES | CCC1(N)N=C(N)NC=C1C(F)(F)F |
| InChI | InChI=1S/C7H11F3N4/c1-2-6(12)4(7(8,9)10)3-13-5(11)14-6/h3H,2,12H2,1H3,(H3,11,13,14) |
| InChIKey | PMMDHPZUZFJSAH-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 76.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.19 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |