C6H12N4 — CID 152780332
4-N,4-dimethyl-1H-pyrimidine-2,4-diamine (PubChem CID 152780332) has the molecular formula C6H12N4 and a molecular weight of 140.19 g/mol. Its IUPAC name is 4-N,4-dimethyl-1H-pyrimidine-2,4-diamine.
| Compound Name | 4-N,4-dimethyl-1H-pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 152780332 |
| Molecular Formula | C6H12N4 |
| Molecular Weight | 140.19 g/mol |
| Exact Mass | 140.11 |
| IUPAC Name | 4-N,4-dimethyl-1H-pyrimidine-2,4-diamine |
| SMILES | CNC1(C)C=CNC(N)=N1 |
| InChI | InChI=1S/C6H12N4/c1-6(8-2)3-4-9-5(7)10-6/h3-4,8H,1-2H3,(H3,7,9,10) |
| InChIKey | WFNVHMWIOYHWFG-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 62.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.19 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |