C24H24N4O5 — CID 154175332
phenyl 4-[2-(3-carbamoyl-4-methoxyquinolin-2-yl)acetyl]piperazine-1-carboxylate (PubChem CID 154175332) has the molecular formula C24H24N4O5 and a molecular weight of 448.48 g/mol. Its IUPAC name is phenyl 4-[2-(3-carbamoyl-4-methoxyquinolin-2-yl)acetyl]piperazine-1-carboxylate.
| Compound Name | phenyl 4-[2-(3-carbamoyl-4-methoxyquinolin-2-yl)acetyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 154175332 |
| Molecular Formula | C24H24N4O5 |
| Molecular Weight | 448.48 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | phenyl 4-[2-(3-carbamoyl-4-methoxyquinolin-2-yl)acetyl]piperazine-1-carboxylate |
| SMILES | COc1c(C(N)=O)c(CC(=O)N2CCN(C(=O)Oc3ccccc3)CC2)nc2ccccc12 |
| InChI | InChI=1S/C24H24N4O5/c1-32-22-17-9-5-6-10-18(17)26-19(21(22)23(25)30)15-20(29)27-11-13-28(14-12-27)24(31)33-16-7-3-2-4-8-16/h2-10H,11-15H2,1H3,(H2,25,30) |
| InChIKey | HHSMPRGFBRIJPP-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.48 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |