C25H26N4O5 — CID 154187740
benzyl 4-[2-(3-carbamoyl-4-methoxyquinolin-2-yl)acetyl]piperazine-1-carboxylate (PubChem CID 154187740) has the molecular formula C25H26N4O5 and a molecular weight of 462.51 g/mol. Its IUPAC name is benzyl 4-[2-(3-carbamoyl-4-methoxyquinolin-2-yl)acetyl]piperazine-1-carboxylate.
| Compound Name | benzyl 4-[2-(3-carbamoyl-4-methoxyquinolin-2-yl)acetyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 154187740 |
| Molecular Formula | C25H26N4O5 |
| Molecular Weight | 462.51 g/mol |
| Exact Mass | 462.19 |
| IUPAC Name | benzyl 4-[2-(3-carbamoyl-4-methoxyquinolin-2-yl)acetyl]piperazine-1-carboxylate |
| SMILES | COc1c(C(N)=O)c(CC(=O)N2CCN(C(=O)OCc3ccccc3)CC2)nc2ccccc12 |
| InChI | InChI=1S/C25H26N4O5/c1-33-23-18-9-5-6-10-19(18)27-20(22(23)24(26)31)15-21(30)28-11-13-29(14-12-28)25(32)34-16-17-7-3-2-4-8-17/h2-10H,11-16H2,1H3,(H2,26,31) |
| InChIKey | PXTWMXLPDHXKOH-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.51 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |