About 1-diazo-2H-chrysene
1-diazo-2H-chrysene (PubChem CID 154175464) has the molecular formula C18H12N2
and a molecular weight of 256.31 g/mol. Its IUPAC name is 1-diazo-2H-chrysene.
Molecular Properties
| Compound Name | 1-diazo-2H-chrysene |
| PubChem CID | 154175464 |
| Molecular Formula | C18H12N2 |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | 1-diazo-2H-chrysene |
| SMILES | [N-]=[N+]=C1CC=Cc2c1ccc1c2ccc2ccccc21 |
| InChI | InChI=1S/C18H12N2/c19-20-18-7-3-6-14-16-9-8-12-4-1-2-5-13(12)15(16)10-11-17(14)18/h1-6,8-11H,7H2 |
| InChIKey | SPSGOACNWVYGSI-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 36.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 1-diazo-2H-chrysene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-diazo-2H-chrysene?
The IUPAC name of 1-diazo-2H-chrysene (CID 154175464) is 1-diazo-2H-chrysene.
What is the SMILES notation for 1-diazo-2H-chrysene?
The canonical SMILES for 1-diazo-2H-chrysene is [N-]=[N+]=C1CC=Cc2c1ccc1c2ccc2ccccc21.
What is the InChIKey of 1-diazo-2H-chrysene?
The InChIKey is SPSGOACNWVYGSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12N2/c19-20-18-7-3-6-14-16-9-8-12-4-1-2-5-13(12)15(16)10-11-17(14)18/h1-6,8-11H,7H2.
What are the key properties of 1-diazo-2H-chrysene?
1-diazo-2H-chrysene has a molecular weight of 256.31 g/mol, XLogP of 4.43, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-diazo-2H-chrysene is sourced from PubChem (CID 154175464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).