About 1-diazo-2H-acridine
1-diazo-2H-acridine (PubChem CID 53442907) has the molecular formula C13H9N3
and a molecular weight of 207.24 g/mol. Its IUPAC name is 1-diazo-2H-acridine.
Molecular Properties
| Compound Name | 1-diazo-2H-acridine |
| PubChem CID | 53442907 |
| Molecular Formula | C13H9N3 |
| Molecular Weight | 207.24 g/mol |
| Exact Mass | 207.08 |
| IUPAC Name | 1-diazo-2H-acridine |
| SMILES | [N-]=[N+]=C1CC=Cc2nc3ccccc3cc21 |
| InChI | InChI=1S/C13H9N3/c14-16-13-7-3-6-12-10(13)8-9-4-1-2-5-11(9)15-12/h1-6,8H,7H2 |
| InChIKey | UFVKMNASOFPPPR-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 49.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.24 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 1-diazo-2H-acridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-diazo-2H-acridine?
The IUPAC name of 1-diazo-2H-acridine (CID 53442907) is 1-diazo-2H-acridine.
What is the SMILES notation for 1-diazo-2H-acridine?
The canonical SMILES for 1-diazo-2H-acridine is [N-]=[N+]=C1CC=Cc2nc3ccccc3cc21.
What is the InChIKey of 1-diazo-2H-acridine?
The InChIKey is UFVKMNASOFPPPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9N3/c14-16-13-7-3-6-12-10(13)8-9-4-1-2-5-11(9)15-12/h1-6,8H,7H2.
What are the key properties of 1-diazo-2H-acridine?
1-diazo-2H-acridine has a molecular weight of 207.24 g/mol, XLogP of 2.67, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-diazo-2H-acridine is sourced from PubChem (CID 53442907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).