About acridine-1,2-dione;quinoline
acridine-1,2-dione;quinoline (PubChem CID 174809652) has the molecular formula C22H14N2O2
and a molecular weight of 338.37 g/mol. Its IUPAC name is acridine-1,2-dione;quinoline.
Molecular Properties
| Compound Name | acridine-1,2-dione;quinoline |
| PubChem CID | 174809652 |
| Molecular Formula | C22H14N2O2 |
| Molecular Weight | 338.37 g/mol |
| Exact Mass | 338.11 |
| IUPAC Name | acridine-1,2-dione;quinoline |
| SMILES | O=C1C=Cc2nc3ccccc3cc2C1=O.c1ccc2ncccc2c1 |
| InChI | InChI=1S/C13H7NO2.C9H7N/c15-12-6-5-11-9(13(12)16)7-8-3-1-2-4-10(8)14-11;1-2-6-9-8(4-1)5-3-7-10-9/h1-7H;1-7H |
| InChIKey | XRRUHEBCYJAAIM-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.37 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze acridine-1,2-dione;quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acridine-1,2-dione;quinoline?
The IUPAC name of acridine-1,2-dione;quinoline (CID 174809652) is acridine-1,2-dione;quinoline.
What is the SMILES notation for acridine-1,2-dione;quinoline?
The canonical SMILES for acridine-1,2-dione;quinoline is O=C1C=Cc2nc3ccccc3cc2C1=O.c1ccc2ncccc2c1.
What is the InChIKey of acridine-1,2-dione;quinoline?
The InChIKey is XRRUHEBCYJAAIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H7NO2.C9H7N/c15-12-6-5-11-9(13(12)16)7-8-3-1-2-4-10(8)14-11;1-2-6-9-8(4-1)5-3-7-10-9/h1-7H;1-7H.
What are the key properties of acridine-1,2-dione;quinoline?
acridine-1,2-dione;quinoline has a molecular weight of 338.37 g/mol, XLogP of 4.25, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for acridine-1,2-dione;quinoline is sourced from PubChem (CID 174809652), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).