About bis(phosphoryl trichloride);quinoline
bis(phosphoryl trichloride);quinoline (PubChem CID 162140508) has the molecular formula C9H7Cl6NO2P2
and a molecular weight of 435.83 g/mol. Its IUPAC name is bis(phosphoryl trichloride);quinoline.
Molecular Properties
| Compound Name | bis(phosphoryl trichloride);quinoline |
| PubChem CID | 162140508 |
| Molecular Formula | C9H7Cl6NO2P2 |
| Molecular Weight | 435.83 g/mol |
| Exact Mass | 432.81 |
| IUPAC Name | bis(phosphoryl trichloride);quinoline |
| SMILES | O=P(Cl)(Cl)Cl.O=P(Cl)(Cl)Cl.c1ccc2ncccc2c1 |
| InChI | InChI=1S/C9H7N.2Cl3OP/c1-2-6-9-8(4-1)5-3-7-10-9;2*1-5(2,3)4/h1-7H;; |
| InChIKey | ZJWDGPRPHREINL-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 435.83 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze bis(phosphoryl trichloride);quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(phosphoryl trichloride);quinoline?
The IUPAC name of bis(phosphoryl trichloride);quinoline (CID 162140508) is bis(phosphoryl trichloride);quinoline.
What is the SMILES notation for bis(phosphoryl trichloride);quinoline?
The canonical SMILES for bis(phosphoryl trichloride);quinoline is O=P(Cl)(Cl)Cl.O=P(Cl)(Cl)Cl.c1ccc2ncccc2c1.
What is the InChIKey of bis(phosphoryl trichloride);quinoline?
The InChIKey is ZJWDGPRPHREINL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N.2Cl3OP/c1-2-6-9-8(4-1)5-3-7-10-9;2*1-5(2,3)4/h1-7H;;.
What are the key properties of bis(phosphoryl trichloride);quinoline?
bis(phosphoryl trichloride);quinoline has a molecular weight of 435.83 g/mol, XLogP of 7.86, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for bis(phosphoryl trichloride);quinoline is sourced from PubChem (CID 162140508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).