About dichloroplatinum;quinoline
dichloroplatinum;quinoline (PubChem CID 6098032) has the molecular formula C18H14Cl2N2Pt
and a molecular weight of 524.31 g/mol. Its IUPAC name is dichloroplatinum;quinoline.
Molecular Properties
| Compound Name | dichloroplatinum;quinoline |
| PubChem CID | 6098032 |
| Molecular Formula | C18H14Cl2N2Pt |
| Molecular Weight | 524.31 g/mol |
| Exact Mass | 523.02 |
| IUPAC Name | dichloroplatinum;quinoline |
| SMILES | Cl[Pt]Cl.c1ccc2ncccc2c1.c1ccc2ncccc2c1 |
| InChI | InChI=1S/2C9H7N.2ClH.Pt/c2*1-2-6-9-8(4-1)5-3-7-10-9;;;/h2*1-7H;2*1H;/q;;;;+2/p-2 |
| InChIKey | OTCCCHHYISGLNT-UHFFFAOYSA-L |
| XLogP | 5.85 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 524.31 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze dichloroplatinum;quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloroplatinum;quinoline?
The IUPAC name of dichloroplatinum;quinoline (CID 6098032) is dichloroplatinum;quinoline.
What is the SMILES notation for dichloroplatinum;quinoline?
The canonical SMILES for dichloroplatinum;quinoline is Cl[Pt]Cl.c1ccc2ncccc2c1.c1ccc2ncccc2c1.
What is the InChIKey of dichloroplatinum;quinoline?
The InChIKey is OTCCCHHYISGLNT-UHFFFAOYSA-L. The full InChI is InChI=1S/2C9H7N.2ClH.Pt/c2*1-2-6-9-8(4-1)5-3-7-10-9;;;/h2*1-7H;2*1H;/q;;;;+2/p-2.
What are the key properties of dichloroplatinum;quinoline?
dichloroplatinum;quinoline has a molecular weight of 524.31 g/mol, XLogP of 5.85, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dichloroplatinum;quinoline is sourced from PubChem (CID 6098032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).