About azanide;dichloroplatinum;quinoline
azanide;dichloroplatinum;quinoline (PubChem CID 4545407) has the molecular formula C9H9Cl2N2Pt-
and a molecular weight of 411.17 g/mol. Its IUPAC name is azanide;dichloroplatinum;quinoline.
Molecular Properties
| Compound Name | azanide;dichloroplatinum;quinoline |
| PubChem CID | 4545407 |
| Molecular Formula | C9H9Cl2N2Pt- |
| Molecular Weight | 411.17 g/mol |
| Exact Mass | 409.98 |
| IUPAC Name | azanide;dichloroplatinum;quinoline |
| SMILES | Cl[Pt]Cl.[NH2-].c1ccc2ncccc2c1 |
| InChI | InChI=1S/C9H7N.2ClH.H2N.Pt/c1-2-6-9-8(4-1)5-3-7-10-9;;;;/h1-7H;2*1H;1H2;/q;;;-1;+2/p-2 |
| InChIKey | SGOZOBZFCQCEMU-UHFFFAOYSA-L |
| XLogP | 4.33 |
| TPSA | 46.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 411.17 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze azanide;dichloroplatinum;quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azanide;dichloroplatinum;quinoline?
The IUPAC name of azanide;dichloroplatinum;quinoline (CID 4545407) is azanide;dichloroplatinum;quinoline.
What is the SMILES notation for azanide;dichloroplatinum;quinoline?
The canonical SMILES for azanide;dichloroplatinum;quinoline is Cl[Pt]Cl.[NH2-].c1ccc2ncccc2c1.
What is the InChIKey of azanide;dichloroplatinum;quinoline?
The InChIKey is SGOZOBZFCQCEMU-UHFFFAOYSA-L. The full InChI is InChI=1S/C9H7N.2ClH.H2N.Pt/c1-2-6-9-8(4-1)5-3-7-10-9;;;;/h1-7H;2*1H;1H2;/q;;;-1;+2/p-2.
What are the key properties of azanide;dichloroplatinum;quinoline?
azanide;dichloroplatinum;quinoline has a molecular weight of 411.17 g/mol, XLogP of 4.33, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for azanide;dichloroplatinum;quinoline is sourced from PubChem (CID 4545407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).