C20H31N5O3S — CID 154178373
1-[[4-(2-methoxyethylamino)-1,2,5-thiadiazol-3-yl]amino]-3-[3-(piperidin-1-ylmethyl)phenoxy]propan-2-ol (PubChem CID 154178373) has the molecular formula C20H31N5O3S and a molecular weight of 421.57 g/mol. Its IUPAC name is 1-[[4-(2-methoxyethylamino)-1,2,5-thiadiazol-3-yl]amino]-3-[3-(piperidin-1-ylmethyl)phenoxy]propan-2-ol.
| Compound Name | 1-[[4-(2-methoxyethylamino)-1,2,5-thiadiazol-3-yl]amino]-3-[3-(piperidin-1-ylmethyl)phenoxy]propan-2-ol |
|---|---|
| PubChem CID | 154178373 |
| Molecular Formula | C20H31N5O3S |
| Molecular Weight | 421.57 g/mol |
| Exact Mass | 421.21 |
| IUPAC Name | 1-[[4-(2-methoxyethylamino)-1,2,5-thiadiazol-3-yl]amino]-3-[3-(piperidin-1-ylmethyl)phenoxy]propan-2-ol |
| SMILES | COCCNc1nsnc1NCC(O)COc1cccc(CN2CCCCC2)c1 |
| InChI | InChI=1S/C20H31N5O3S/c1-27-11-8-21-19-20(24-29-23-19)22-13-17(26)15-28-18-7-5-6-16(12-18)14-25-9-3-2-4-10-25/h5-7,12,17,26H,2-4,8-11,13-15H2,1H3,(H,21,23)(H,22,24) |
| InChIKey | YJMNDSUCTVXHFM-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 91.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.57 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|