C10H8Cl2N2OS — CID 154178831
2-(5,6-dichloro-1H-benzimidazol-2-yl)propanethioic S-acid (PubChem CID 154178831) has the molecular formula C10H8Cl2N2OS and a molecular weight of 275.16 g/mol. Its IUPAC name is 2-(5,6-dichloro-1H-benzimidazol-2-yl)propanethioic S-acid.
| Compound Name | 2-(5,6-dichloro-1H-benzimidazol-2-yl)propanethioic S-acid |
|---|---|
| PubChem CID | 154178831 |
| Molecular Formula | C10H8Cl2N2OS |
| Molecular Weight | 275.16 g/mol |
| Exact Mass | 273.97 |
| IUPAC Name | 2-(5,6-dichloro-1H-benzimidazol-2-yl)propanethioic S-acid |
| SMILES | CC(C(=O)S)c1nc2cc(Cl)c(Cl)cc2[nH]1 |
| InChI | InChI=1S/C10H8Cl2N2OS/c1-4(10(15)16)9-13-7-2-5(11)6(12)3-8(7)14-9/h2-4H,1H3,(H,13,14)(H,15,16) |
| InChIKey | BJNPMCPBAUYFAV-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.16 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|