C9H9Cl2N3 — CID 91621375
5,6-dichloro-N,N-dimethyl-1H-benzimidazol-2-amine (PubChem CID 91621375) has the molecular formula C9H9Cl2N3 and a molecular weight of 230.10 g/mol. Its IUPAC name is 5,6-dichloro-N,N-dimethyl-1H-benzimidazol-2-amine.
| Compound Name | 5,6-dichloro-N,N-dimethyl-1H-benzimidazol-2-amine |
|---|---|
| PubChem CID | 91621375 |
| Molecular Formula | C9H9Cl2N3 |
| Molecular Weight | 230.10 g/mol |
| Exact Mass | 229.02 |
| IUPAC Name | 5,6-dichloro-N,N-dimethyl-1H-benzimidazol-2-amine |
| SMILES | CN(C)c1nc2cc(Cl)c(Cl)cc2[nH]1 |
| InChI | InChI=1S/C9H9Cl2N3/c1-14(2)9-12-7-3-5(10)6(11)4-8(7)13-9/h3-4H,1-2H3,(H,12,13) |
| InChIKey | FTUCLYJNACZKPY-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.10 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |