About 1-(dimethylamino)ethyl 2-oxopyrrolidine-1-carboxylate
1-(dimethylamino)ethyl 2-oxopyrrolidine-1-carboxylate (PubChem CID 154183318) has the molecular formula C9H16N2O3
and a molecular weight of 200.24 g/mol. Its IUPAC name is 1-(dimethylamino)ethyl 2-oxopyrrolidine-1-carboxylate.
Molecular Properties
| Compound Name | 1-(dimethylamino)ethyl 2-oxopyrrolidine-1-carboxylate |
| PubChem CID | 154183318 |
| Molecular Formula | C9H16N2O3 |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.12 |
| IUPAC Name | 1-(dimethylamino)ethyl 2-oxopyrrolidine-1-carboxylate |
| SMILES | CC(OC(=O)N1CCCC1=O)N(C)C |
| InChI | InChI=1S/C9H16N2O3/c1-7(10(2)3)14-9(13)11-6-4-5-8(11)12/h7H,4-6H2,1-3H3 |
| InChIKey | QSDVKPUQXLIOLV-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-(dimethylamino)ethyl 2-oxopyrrolidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(dimethylamino)ethyl 2-oxopyrrolidine-1-carboxylate?
The IUPAC name of 1-(dimethylamino)ethyl 2-oxopyrrolidine-1-carboxylate (CID 154183318) is 1-(dimethylamino)ethyl 2-oxopyrrolidine-1-carboxylate.
What is the SMILES notation for 1-(dimethylamino)ethyl 2-oxopyrrolidine-1-carboxylate?
The canonical SMILES for 1-(dimethylamino)ethyl 2-oxopyrrolidine-1-carboxylate is CC(OC(=O)N1CCCC1=O)N(C)C.
What is the InChIKey of 1-(dimethylamino)ethyl 2-oxopyrrolidine-1-carboxylate?
The InChIKey is QSDVKPUQXLIOLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2O3/c1-7(10(2)3)14-9(13)11-6-4-5-8(11)12/h7H,4-6H2,1-3H3.
What are the key properties of 1-(dimethylamino)ethyl 2-oxopyrrolidine-1-carboxylate?
1-(dimethylamino)ethyl 2-oxopyrrolidine-1-carboxylate has a molecular weight of 200.24 g/mol, XLogP of 0.65, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(dimethylamino)ethyl 2-oxopyrrolidine-1-carboxylate is sourced from PubChem (CID 154183318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).