C21H29F3N4O4S — CID 154188003
N-[9-hydroxy-1-[[4-[5-(trifluoromethyl)-2-pyridinyl]-1,4-diazepan-1-yl]sulfonyl]non-3-yn-2-yl]formamide (PubChem CID 154188003) has the molecular formula C21H29F3N4O4S and a molecular weight of 490.55 g/mol. Its IUPAC name is N-[9-hydroxy-1-[[4-[5-(trifluoromethyl)-2-pyridinyl]-1,4-diazepan-1-yl]sulfonyl]non-3-yn-2-yl]formamide.
| Compound Name | N-[9-hydroxy-1-[[4-[5-(trifluoromethyl)-2-pyridinyl]-1,4-diazepan-1-yl]sulfonyl]non-3-yn-2-yl]formamide |
|---|---|
| PubChem CID | 154188003 |
| Molecular Formula | C21H29F3N4O4S |
| Molecular Weight | 490.55 g/mol |
| Exact Mass | 490.19 |
| IUPAC Name | N-[9-hydroxy-1-[[4-[5-(trifluoromethyl)-2-pyridinyl]-1,4-diazepan-1-yl]sulfonyl]non-3-yn-2-yl]formamide |
| SMILES | O=CNC(C#CCCCCCO)CS(=O)(=O)N1CCCN(c2ccc(C(F)(F)F)cn2)CC1 |
| InChI | InChI=1S/C21H29F3N4O4S/c22-21(23,24)18-8-9-20(25-15-18)27-10-6-11-28(13-12-27)33(31,32)16-19(26-17-30)7-4-2-1-3-5-14-29/h8-9,15,17,19,29H,1-3,5-6,10-14,16H2,(H,26,30) |
| InChIKey | CTCLQJUHMVTIAM-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 102.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.55 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|