C16H12N2 — CID 154188379
4-methyl-5H-indeno[1,2-b][1,8]naphthyridine (PubChem CID 154188379) has the molecular formula C16H12N2 and a molecular weight of 232.29 g/mol. Its IUPAC name is 4-methyl-5H-indeno[1,2-b][1,8]naphthyridine.
| Compound Name | 4-methyl-5H-indeno[1,2-b][1,8]naphthyridine |
|---|---|
| PubChem CID | 154188379 |
| Molecular Formula | C16H12N2 |
| Molecular Weight | 232.29 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | 4-methyl-5H-indeno[1,2-b][1,8]naphthyridine |
| SMILES | Cc1ccnc2c1CC1=Cc3ccccc3C1=N2 |
| InChI | InChI=1S/C16H12N2/c1-10-6-7-17-16-14(10)9-12-8-11-4-2-3-5-13(11)15(12)18-16/h2-8H,9H2,1H3 |
| InChIKey | ZEEWBCWEDKCMLA-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.29 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |