C16H12BrNS — CID 15419001
4-bromo-N,N-diphenylthiophen-3-amine (PubChem CID 15419001) has the molecular formula C16H12BrNS and a molecular weight of 330.25 g/mol. Its IUPAC name is 4-bromo-N,N-diphenylthiophen-3-amine.
| Compound Name | 4-bromo-N,N-diphenylthiophen-3-amine |
|---|---|
| PubChem CID | 15419001 |
| Molecular Formula | C16H12BrNS |
| Molecular Weight | 330.25 g/mol |
| Exact Mass | 328.99 |
| IUPAC Name | 4-bromo-N,N-diphenylthiophen-3-amine |
| SMILES | Brc1cscc1N(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H12BrNS/c17-15-11-19-12-16(15)18(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-12H |
| InChIKey | YTQANCPLCWUIAQ-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.25 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |