C26H43NO2Si — CID 15419309
2,2-diethyl-1-[3-[tri(propan-2-yl)silyloxymethyl]indol-1-yl]butan-1-one (PubChem CID 15419309) has the molecular formula C26H43NO2Si and a molecular weight of 429.72 g/mol. Its IUPAC name is 2,2-diethyl-1-[3-[tri(propan-2-yl)silyloxymethyl]indol-1-yl]butan-1-one.
| Compound Name | 2,2-diethyl-1-[3-[tri(propan-2-yl)silyloxymethyl]indol-1-yl]butan-1-one |
|---|---|
| PubChem CID | 15419309 |
| Molecular Formula | C26H43NO2Si |
| Molecular Weight | 429.72 g/mol |
| Exact Mass | 429.31 |
| IUPAC Name | 2,2-diethyl-1-[3-[tri(propan-2-yl)silyloxymethyl]indol-1-yl]butan-1-one |
| SMILES | CCC(CC)(CC)C(=O)n1cc(CO[Si](C(C)C)(C(C)C)C(C)C)c2ccccc21 |
| InChI | InChI=1S/C26H43NO2Si/c1-10-26(11-2,12-3)25(28)27-17-22(23-15-13-14-16-24(23)27)18-29-30(19(4)5,20(6)7)21(8)9/h13-17,19-21H,10-12,18H2,1-9H3 |
| InChIKey | KRZSGUGSSRMHNG-UHFFFAOYSA-N |
| XLogP | 8.19 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.72 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|