About 1-phenoxy-3-propa-1,2-dienylbenzene
1-phenoxy-3-propa-1,2-dienylbenzene (PubChem CID 15419608) has the molecular formula C15H12O
and a molecular weight of 208.26 g/mol. Its IUPAC name is 1-phenoxy-3-propa-1,2-dienylbenzene.
Molecular Properties
| Compound Name | 1-phenoxy-3-propa-1,2-dienylbenzene |
| PubChem CID | 15419608 |
| Molecular Formula | C15H12O |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.09 |
| IUPAC Name | 1-phenoxy-3-propa-1,2-dienylbenzene |
| SMILES | C=C=Cc1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C15H12O/c1-2-7-13-8-6-11-15(12-13)16-14-9-4-3-5-10-14/h3-12H,1H2 |
| InChIKey | TYMMSIQBSVLCKY-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-phenoxy-3-propa-1,2-dienylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenoxy-3-propa-1,2-dienylbenzene?
The IUPAC name of 1-phenoxy-3-propa-1,2-dienylbenzene (CID 15419608) is 1-phenoxy-3-propa-1,2-dienylbenzene.
What is the SMILES notation for 1-phenoxy-3-propa-1,2-dienylbenzene?
The canonical SMILES for 1-phenoxy-3-propa-1,2-dienylbenzene is C=C=Cc1cccc(Oc2ccccc2)c1.
What is the InChIKey of 1-phenoxy-3-propa-1,2-dienylbenzene?
The InChIKey is TYMMSIQBSVLCKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12O/c1-2-7-13-8-6-11-15(12-13)16-14-9-4-3-5-10-14/h3-12H,1H2.
What are the key properties of 1-phenoxy-3-propa-1,2-dienylbenzene?
1-phenoxy-3-propa-1,2-dienylbenzene has a molecular weight of 208.26 g/mol, XLogP of 4.28, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenoxy-3-propa-1,2-dienylbenzene is sourced from PubChem (CID 15419608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).