C6H6FN3O3 — CID 154200609
N-(2,4-dioxo-1H-pyrimidin-5-yl)-2-fluoroacetamide (PubChem CID 154200609) has the molecular formula C6H6FN3O3 and a molecular weight of 187.13 g/mol. Its IUPAC name is N-(2,4-dioxo-1H-pyrimidin-5-yl)-2-fluoroacetamide.
| Compound Name | N-(2,4-dioxo-1H-pyrimidin-5-yl)-2-fluoroacetamide |
|---|---|
| PubChem CID | 154200609 |
| Molecular Formula | C6H6FN3O3 |
| Molecular Weight | 187.13 g/mol |
| Exact Mass | 187.04 |
| IUPAC Name | N-(2,4-dioxo-1H-pyrimidin-5-yl)-2-fluoroacetamide |
| SMILES | O=C(CF)Nc1c[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C6H6FN3O3/c7-1-4(11)9-3-2-8-6(13)10-5(3)12/h2H,1H2,(H,9,11)(H2,8,10,12,13) |
| InChIKey | WACMZHFOPKUGHB-UHFFFAOYSA-N |
| XLogP | -1.03 |
| TPSA | 94.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.13 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |