(2R,3R)-2,3-di(but-2-enoyl)-2,3-dihydroxybutanedioic acid

C12H14O8 — CID 154210618

IUPAC(2R,3R)-2,3-di(but-2-enoyl)-2,3-dihydroxybutanedioic acid
SMILESCC=CC(=O)[C@@](O)(C(=O)O)[C@](O)(C(=O)O)C(=O)C=CC
InChIInChI=1S/C12H14O8/c1-3-5-7(13)11(19,9(15)16)12(20,10(17)18)8(14)6-4-2/h3-6,19-20H,1-2H3,(H,15,16)(H,17,18)/t11-,12-/m1/s1
InChIKeyLWDDZKKJZVRUKD-VXGBXAGGSA-N
MW286.24 g/mol
LogP-1.09
Rot. Bonds7

About (2R,3R)-2,3-di(but-2-enoyl)-2,3-dihydroxybutanedioic acid

(2R,3R)-2,3-di(but-2-enoyl)-2,3-dihydroxybutanedioic acid (PubChem CID 154210618) has the molecular formula C12H14O8 and a molecular weight of 286.24 g/mol. Its IUPAC name is (2R,3R)-2,3-di(but-2-enoyl)-2,3-dihydroxybutanedioic acid.

Molecular Properties

Compound Name(2R,3R)-2,3-di(but-2-enoyl)-2,3-dihydroxybutanedioic acid
PubChem CID154210618
Molecular FormulaC12H14O8
Molecular Weight286.24 g/mol
Exact Mass286.07
IUPAC Name(2R,3R)-2,3-di(but-2-enoyl)-2,3-dihydroxybutanedioic acid
SMILESCC=CC(=O)[C@@](O)(C(=O)O)[C@](O)(C(=O)O)C(=O)C=CC
InChIInChI=1S/C12H14O8/c1-3-5-7(13)11(19,9(15)16)12(20,10(17)18)8(14)6-4-2/h3-6,19-20H,1-2H3,(H,15,16)(H,17,18)/t11-,12-/m1/s1
InChIKeyLWDDZKKJZVRUKD-VXGBXAGGSA-N
XLogP-1.09
TPSA149.20 Ų
H-Bond Donors4
H-Bond Acceptors6
Rotatable Bonds7
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500286.24
LogP ≤ 5-1.09
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze (2R,3R)-2,3-di(but-2-enoyl)-2,3-dihydroxybutanedioic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2R,3R)-2,3-di(but-2-enoyl)-2,3-dihydroxybutanedioic acid?
The IUPAC name of (2R,3R)-2,3-di(but-2-enoyl)-2,3-dihydroxybutanedioic acid (CID 154210618) is (2R,3R)-2,3-di(but-2-enoyl)-2,3-dihydroxybutanedioic acid.
What is the SMILES notation for (2R,3R)-2,3-di(but-2-enoyl)-2,3-dihydroxybutanedioic acid?
The canonical SMILES for (2R,3R)-2,3-di(but-2-enoyl)-2,3-dihydroxybutanedioic acid is CC=CC(=O)[C@@](O)(C(=O)O)[C@](O)(C(=O)O)C(=O)C=CC.
What is the InChIKey of (2R,3R)-2,3-di(but-2-enoyl)-2,3-dihydroxybutanedioic acid?
The InChIKey is LWDDZKKJZVRUKD-VXGBXAGGSA-N. The full InChI is InChI=1S/C12H14O8/c1-3-5-7(13)11(19,9(15)16)12(20,10(17)18)8(14)6-4-2/h3-6,19-20H,1-2H3,(H,15,16)(H,17,18)/t11-,12-/m1/s1.
What are the key properties of (2R,3R)-2,3-di(but-2-enoyl)-2,3-dihydroxybutanedioic acid?
(2R,3R)-2,3-di(but-2-enoyl)-2,3-dihydroxybutanedioic acid has a molecular weight of 286.24 g/mol, XLogP of -1.09, 7 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,3R)-2,3-di(but-2-enoyl)-2,3-dihydroxybutanedioic acid is sourced from PubChem (CID 154210618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).