1-hydroxy-6,6-dimethyl-2-oxocyclohex-3-ene-1-carboxylic acid

C9H12O4 — CID 172796847

IUPAC1-hydroxy-6,6-dimethyl-2-oxocyclohex-3-ene-1-carboxylic acid
SMILESCC1(C)CC=CC(=O)C1(O)C(=O)O
InChIInChI=1S/C9H12O4/c1-8(2)5-3-4-6(10)9(8,13)7(11)12/h3-4,13H,5H2,1-2H3,(H,11,12)
InChIKeyQHYHWJXIGFBIOB-UHFFFAOYSA-N
MW184.19 g/mol
LogP0.36
Rot. Bonds1

About 1-hydroxy-6,6-dimethyl-2-oxocyclohex-3-ene-1-carboxylic acid

1-hydroxy-6,6-dimethyl-2-oxocyclohex-3-ene-1-carboxylic acid (PubChem CID 172796847) has the molecular formula C9H12O4 and a molecular weight of 184.19 g/mol. Its IUPAC name is 1-hydroxy-6,6-dimethyl-2-oxocyclohex-3-ene-1-carboxylic acid.

Molecular Properties

Compound Name1-hydroxy-6,6-dimethyl-2-oxocyclohex-3-ene-1-carboxylic acid
PubChem CID172796847
Molecular FormulaC9H12O4
Molecular Weight184.19 g/mol
Exact Mass184.07
IUPAC Name1-hydroxy-6,6-dimethyl-2-oxocyclohex-3-ene-1-carboxylic acid
SMILESCC1(C)CC=CC(=O)C1(O)C(=O)O
InChIInChI=1S/C9H12O4/c1-8(2)5-3-4-6(10)9(8,13)7(11)12/h3-4,13H,5H2,1-2H3,(H,11,12)
InChIKeyQHYHWJXIGFBIOB-UHFFFAOYSA-N
XLogP0.36
TPSA74.60 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500184.19
LogP ≤ 50.36
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}

Analyze 1-hydroxy-6,6-dimethyl-2-oxocyclohex-3-ene-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-hydroxy-6,6-dimethyl-2-oxocyclohex-3-ene-1-carboxylic acid?
The IUPAC name of 1-hydroxy-6,6-dimethyl-2-oxocyclohex-3-ene-1-carboxylic acid (CID 172796847) is 1-hydroxy-6,6-dimethyl-2-oxocyclohex-3-ene-1-carboxylic acid.
What is the SMILES notation for 1-hydroxy-6,6-dimethyl-2-oxocyclohex-3-ene-1-carboxylic acid?
The canonical SMILES for 1-hydroxy-6,6-dimethyl-2-oxocyclohex-3-ene-1-carboxylic acid is CC1(C)CC=CC(=O)C1(O)C(=O)O.
What is the InChIKey of 1-hydroxy-6,6-dimethyl-2-oxocyclohex-3-ene-1-carboxylic acid?
The InChIKey is QHYHWJXIGFBIOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O4/c1-8(2)5-3-4-6(10)9(8,13)7(11)12/h3-4,13H,5H2,1-2H3,(H,11,12).
What are the key properties of 1-hydroxy-6,6-dimethyl-2-oxocyclohex-3-ene-1-carboxylic acid?
1-hydroxy-6,6-dimethyl-2-oxocyclohex-3-ene-1-carboxylic acid has a molecular weight of 184.19 g/mol, XLogP of 0.36, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxy-6,6-dimethyl-2-oxocyclohex-3-ene-1-carboxylic acid is sourced from PubChem (CID 172796847), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).