C9H12O4 — CID 172796847
1-hydroxy-6,6-dimethyl-2-oxocyclohex-3-ene-1-carboxylic acid (PubChem CID 172796847) has the molecular formula C9H12O4 and a molecular weight of 184.19 g/mol. Its IUPAC name is 1-hydroxy-6,6-dimethyl-2-oxocyclohex-3-ene-1-carboxylic acid.
| Compound Name | 1-hydroxy-6,6-dimethyl-2-oxocyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 172796847 |
| Molecular Formula | C9H12O4 |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | 1-hydroxy-6,6-dimethyl-2-oxocyclohex-3-ene-1-carboxylic acid |
| SMILES | CC1(C)CC=CC(=O)C1(O)C(=O)O |
| InChI | InChI=1S/C9H12O4/c1-8(2)5-3-4-6(10)9(8,13)7(11)12/h3-4,13H,5H2,1-2H3,(H,11,12) |
| InChIKey | QHYHWJXIGFBIOB-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|