C14H20O3 — CID 82254363
1-[(Z)-but-2-enoyl]-2,6,6-trimethylcyclohex-3-ene-1-carboxylic acid (PubChem CID 82254363) has the molecular formula C14H20O3 and a molecular weight of 236.31 g/mol. Its IUPAC name is 1-[(Z)-but-2-enoyl]-2,6,6-trimethylcyclohex-3-ene-1-carboxylic acid.
| Compound Name | 1-[(Z)-but-2-enoyl]-2,6,6-trimethylcyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 82254363 |
| Molecular Formula | C14H20O3 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | 1-[(Z)-but-2-enoyl]-2,6,6-trimethylcyclohex-3-ene-1-carboxylic acid |
| SMILES | C/C=C\C(=O)C1(C(=O)O)C(C)C=CCC1(C)C |
| InChI | InChI=1S/C14H20O3/c1-5-7-11(15)14(12(16)17)10(2)8-6-9-13(14,3)4/h5-8,10H,9H2,1-4H3,(H,16,17)/b7-5- |
| InChIKey | ZVTPJFJFXLYSSU-ALCCZGGFSA-N |
| XLogP | 2.82 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|