C15H24O8 — CID 160571705
2-hydroxypropane-1,2,3-tricarboxylic acid;non-3-en-2-one (PubChem CID 160571705) has the molecular formula C15H24O8 and a molecular weight of 332.35 g/mol. Its IUPAC name is 2-hydroxypropane-1,2,3-tricarboxylic acid;non-3-en-2-one.
| Compound Name | 2-hydroxypropane-1,2,3-tricarboxylic acid;non-3-en-2-one |
|---|---|
| PubChem CID | 160571705 |
| Molecular Formula | C15H24O8 |
| Molecular Weight | 332.35 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | 2-hydroxypropane-1,2,3-tricarboxylic acid;non-3-en-2-one |
| SMILES | CCCCCC=CC(C)=O.O=C(O)CC(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C9H16O.C6H8O7/c1-3-4-5-6-7-8-9(2)10;7-3(8)1-6(13,5(11)12)2-4(9)10/h7-8H,3-6H2,1-2H3;13H,1-2H2,(H,7,8)(H,9,10)(H,11,12) |
| InChIKey | RAQCDGYYLTZGFJ-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.35 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|