C12H18O7 — CID 158776946
cyclohexene;2-hydroxypropane-1,2,3-tricarboxylic acid (PubChem CID 158776946) has the molecular formula C12H18O7 and a molecular weight of 274.27 g/mol. Its IUPAC name is cyclohexene;2-hydroxypropane-1,2,3-tricarboxylic acid.
| Compound Name | cyclohexene;2-hydroxypropane-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 158776946 |
| Molecular Formula | C12H18O7 |
| Molecular Weight | 274.27 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | cyclohexene;2-hydroxypropane-1,2,3-tricarboxylic acid |
| SMILES | C1=CCCCC1.O=C(O)CC(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C6H8O7.C6H10/c7-3(8)1-6(13,5(11)12)2-4(9)10;1-2-4-6-5-3-1/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);1-2H,3-6H2 |
| InChIKey | IQOVYSQMWKKQTJ-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 132.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.27 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|