C14H22O5 — CID 90707419
2-(3,7-dimethylocta-2,6-dienyl)-2-hydroxybutanedioic acid (PubChem CID 90707419) has the molecular formula C14H22O5 and a molecular weight of 270.32 g/mol. Its IUPAC name is 2-(3,7-dimethylocta-2,6-dienyl)-2-hydroxybutanedioic acid.
| Compound Name | 2-(3,7-dimethylocta-2,6-dienyl)-2-hydroxybutanedioic acid |
|---|---|
| PubChem CID | 90707419 |
| Molecular Formula | C14H22O5 |
| Molecular Weight | 270.32 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | 2-(3,7-dimethylocta-2,6-dienyl)-2-hydroxybutanedioic acid |
| SMILES | CC(C)=CCCC(C)=CCC(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C14H22O5/c1-10(2)5-4-6-11(3)7-8-14(19,13(17)18)9-12(15)16/h5,7,19H,4,6,8-9H2,1-3H3,(H,15,16)(H,17,18) |
| InChIKey | UDKJIJPHOGZQNS-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.32 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|