C16H22O8 — CID 142655215
(5E)-2-hydroxy-6,10-dimethyl-4-oxoundeca-5,9-diene-1,2,3-tricarboxylic acid (PubChem CID 142655215) has the molecular formula C16H22O8 and a molecular weight of 342.34 g/mol. Its IUPAC name is (5E)-2-hydroxy-6,10-dimethyl-4-oxoundeca-5,9-diene-1,2,3-tricarboxylic acid.
| Compound Name | (5E)-2-hydroxy-6,10-dimethyl-4-oxoundeca-5,9-diene-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 142655215 |
| Molecular Formula | C16H22O8 |
| Molecular Weight | 342.34 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | (5E)-2-hydroxy-6,10-dimethyl-4-oxoundeca-5,9-diene-1,2,3-tricarboxylic acid |
| SMILES | CC(C)=CCC/C(C)=C/C(=O)C(C(=O)O)C(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C16H22O8/c1-9(2)5-4-6-10(3)7-11(17)13(14(20)21)16(24,15(22)23)8-12(18)19/h5,7,13,24H,4,6,8H2,1-3H3,(H,18,19)(H,20,21)(H,22,23)/b10-7+ |
| InChIKey | BTKGYUSKCSKVRP-JXMROGBWSA-N |
| XLogP | 1.24 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.34 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|