C11H12N2O — CID 15421786
(Z)-2-(4,5-dihydro-1,3-oxazol-2-yl)-1-phenylethenamine (PubChem CID 15421786) has the molecular formula C11H12N2O and a molecular weight of 188.23 g/mol. Its IUPAC name is (Z)-2-(4,5-dihydro-1,3-oxazol-2-yl)-1-phenylethenamine.
| Compound Name | (Z)-2-(4,5-dihydro-1,3-oxazol-2-yl)-1-phenylethenamine |
|---|---|
| PubChem CID | 15421786 |
| Molecular Formula | C11H12N2O |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.09 |
| IUPAC Name | (Z)-2-(4,5-dihydro-1,3-oxazol-2-yl)-1-phenylethenamine |
| SMILES | N/C(=C\C1=NCCO1)c1ccccc1 |
| InChI | InChI=1S/C11H12N2O/c12-10(8-11-13-6-7-14-11)9-4-2-1-3-5-9/h1-5,8H,6-7,12H2/b10-8- |
| InChIKey | KEPHIEKGAUOOBK-NTMALXAHSA-N |
| XLogP | 1.41 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |